|
Entry |
|
|
Classification |
|
|
Carotenoid Name
|
Astaxanthin 5,8-epoxide; Astaxanthin epoxide
|
|
IUPAC name |
5,8-Epoxy-3,3'-dihydroxy-beta,beta-carotene-4,4'-dione
|
|
Formula |
C40H52O5
|
|
Molecular Weight |
612.816 g/mol
|
|
Structure |
Search similar carotenoids

Mol file
|
|
Carotenoid DB Fingerprints |
|
|
Biological functions/Properties |
Astaxanthin epoxides were major reaction products of astaanthin with superoxide anion radicals and hydroxyl radicals. (Ref.779)
|
Number of conjugated double bonds |
10 including one ketone (10 in total)
|
Number of conjugated multiple bonds |
10 including one ketone (10 in total)
|
|
Isomers |
|
|
InChI |
InChI=1S/C40H52O5/c1-26(17-13-18-28(3)21-22-31-30(5)36(43)32(41)24-38(31,6)7)15-11-12-16-27(2)19-14-20-29(4)34-23-35-39(8,9)25-33(42)37(44)40(35,10)45-34/h11-23,32-34,41-42H,24-25H2,1-10H3/b12-11+,17-13+,19-14+,22-21+,26-15+,27-16+,28-18+,29-20+
|
|
InChIKey |
XZMFRIYEAVHLIU-FKJGWRFPSA-N
|
|
Canonical SMILES |
C/C(=C\C=C\C=C(\C=C\C=C(\C1C=C2C(O1)(C)C(=O)C(CC2(C)C)O)/C)/C)/C=C/C=C(/C=C/C1=C(C)C(=O)C(CC1(C)C)O)\C
|
|
XLogP |
7.698
|
Hydrogen Bond donors (Lipinski's definition) |
2
|
Hydrogen Bond Acceptors (Lipinski's definition) |
5
|
| LipinskiFailures |
1
|
| Complexity of molecule |
0.320
|
| Number of heavy atoms |
45
|
TPSA (Topological Polar Surface Area) |
83.830 Å2
|
|
Reaction |
|
|
Pathway |
|
|
Major carotenoid information |
Major reaction products of astaanthin with superoxide anion radicals and hydroxyl radicals. (Ref.779)
|
|
Minor carotenoid information |
|
|
Source organisms |
|
|
References |
Ref.779: Takashi Maoka, Journal of Natural Medicines ISSN 1340-3443 Volume 74 Number 1 J Nat Med (2020) 74:1-16, “Carotenoids as natural functional pigments”, DOI 10.1007/s11418-019-01364-x.
|
|
CAS |
|
|
Links to other DB |
|
|